C24H25F3O3 — CID 139479885
3-[2-(1,1-difluoroethyl)-4-[[2-[(2-fluorophenyl)methyl]cyclopenten-1-yl]methoxy]phenyl]propanoic acid (PubChem CID 139479885) has the molecular formula C24H25F3O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 3-[2-(1,1-difluoroethyl)-4-[[2-[(2-fluorophenyl)methyl]cyclopenten-1-yl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-(1,1-difluoroethyl)-4-[[2-[(2-fluorophenyl)methyl]cyclopenten-1-yl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139479885 |
| Molecular Formula | C24H25F3O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-[2-(1,1-difluoroethyl)-4-[[2-[(2-fluorophenyl)methyl]cyclopenten-1-yl]methoxy]phenyl]propanoic acid |
| SMILES | CC(F)(F)c1cc(OCC2=C(Cc3ccccc3F)CCC2)ccc1CCC(=O)O |
| InChI | InChI=1S/C24H25F3O3/c1-24(26,27)21-14-20(11-9-16(21)10-12-23(28)29)30-15-19-7-4-6-17(19)13-18-5-2-3-8-22(18)25/h2-3,5,8-9,11,14H,4,6-7,10,12-13,15H2,1H3,(H,28,29) |
| InChIKey | WAMIOXLTGUESCC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|