C24H27F2O3P — CID 139479921
3-[4-[(2-benzylcyclohexen-1-yl)methoxy]-2-[difluoro(phosphanyl)methyl]phenyl]propanoic acid (PubChem CID 139479921) has the molecular formula C24H27F2O3P and a molecular weight of 432.45 g/mol. Its IUPAC name is 3-[4-[(2-benzylcyclohexen-1-yl)methoxy]-2-[difluoro(phosphanyl)methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[(2-benzylcyclohexen-1-yl)methoxy]-2-[difluoro(phosphanyl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139479921 |
| Molecular Formula | C24H27F2O3P |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-[4-[(2-benzylcyclohexen-1-yl)methoxy]-2-[difluoro(phosphanyl)methyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCC2=C(Cc3ccccc3)CCCC2)cc1C(F)(F)P |
| InChI | InChI=1S/C24H27F2O3P/c25-24(26,30)22-15-21(12-10-18(22)11-13-23(27)28)29-16-20-9-5-4-8-19(20)14-17-6-2-1-3-7-17/h1-3,6-7,10,12,15H,4-5,8-9,11,13-14,16,30H2,(H,27,28) |
| InChIKey | WUBOYTUTWSQOQM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|