C26H30F2O3 — CID 153340320
3-[4-[(2-benzylcyclohexen-1-yl)methoxy]-2-(1,1-difluoropropyl)phenyl]propanoic acid (PubChem CID 153340320) has the molecular formula C26H30F2O3 and a molecular weight of 428.52 g/mol. Its IUPAC name is 3-[4-[(2-benzylcyclohexen-1-yl)methoxy]-2-(1,1-difluoropropyl)phenyl]propanoic acid.
| Compound Name | 3-[4-[(2-benzylcyclohexen-1-yl)methoxy]-2-(1,1-difluoropropyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 153340320 |
| Molecular Formula | C26H30F2O3 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 3-[4-[(2-benzylcyclohexen-1-yl)methoxy]-2-(1,1-difluoropropyl)phenyl]propanoic acid |
| SMILES | CCC(F)(F)c1cc(OCC2=C(Cc3ccccc3)CCCC2)ccc1CCC(=O)O |
| InChI | InChI=1S/C26H30F2O3/c1-2-26(27,28)24-17-23(14-12-20(24)13-15-25(29)30)31-18-22-11-7-6-10-21(22)16-19-8-4-3-5-9-19/h3-5,8-9,12,14,17H,2,6-7,10-11,13,15-16,18H2,1H3,(H,29,30) |
| InChIKey | SMEIXBKWYJLUON-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|