C21H28O3 — CID 139480051
3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]-2-methylphenyl]propanoic acid (PubChem CID 139480051) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 139480051 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]-2-methylphenyl]propanoic acid |
| SMILES | Cc1cc(OCC2=C(C3CCCC3)CCC2)ccc1CCC(=O)O |
| InChI | InChI=1S/C21H28O3/c1-15-13-19(11-9-16(15)10-12-21(22)23)24-14-18-7-4-8-20(18)17-5-2-3-6-17/h9,11,13,17H,2-8,10,12,14H2,1H3,(H,22,23) |
| InChIKey | LBPJNZUQAIDMCV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|