About 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid
3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid (PubChem CID 139476601) has the molecular formula C20H26O4
and a molecular weight of 330.42 g/mol. Its IUPAC name is 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid |
| PubChem CID | 139476601 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCC2=C(C3CCCC3)CCOC2)cc1 |
| InChI | InChI=1S/C20H26O4/c21-20(22)10-7-15-5-8-18(9-6-15)24-14-17-13-23-12-11-19(17)16-3-1-2-4-16/h5-6,8-9,16H,1-4,7,10-14H2,(H,21,22) |
| InChIKey | MYPOJROUUQPGPJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid?
The IUPAC name of 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid (CID 139476601) is 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid.
What is the SMILES notation for 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid?
The canonical SMILES for 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid is O=C(O)CCc1ccc(OCC2=C(C3CCCC3)CCOC2)cc1.
What is the InChIKey of 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid?
The InChIKey is MYPOJROUUQPGPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O4/c21-20(22)10-7-15-5-8-18(9-6-15)24-14-17-13-23-12-11-19(17)16-3-1-2-4-16/h5-6,8-9,16H,1-4,7,10-14H2,(H,21,22).
What are the key properties of 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid?
3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid has a molecular weight of 330.42 g/mol, XLogP of 3.99, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(4-cyclopentyl-3,6-dihydro-2H-pyran-5-yl)methoxy]phenyl]propanoic acid is sourced from PubChem (CID 139476601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).