C24H26F2O4 — CID 139477283
3-[4-[(4-benzyl-3,6-dihydro-2H-pyran-5-yl)methoxy]-2-(1,1-difluoroethyl)phenyl]propanoic acid (PubChem CID 139477283) has the molecular formula C24H26F2O4 and a molecular weight of 416.46 g/mol. Its IUPAC name is 3-[4-[(4-benzyl-3,6-dihydro-2H-pyran-5-yl)methoxy]-2-(1,1-difluoroethyl)phenyl]propanoic acid.
| Compound Name | 3-[4-[(4-benzyl-3,6-dihydro-2H-pyran-5-yl)methoxy]-2-(1,1-difluoroethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 139477283 |
| Molecular Formula | C24H26F2O4 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 3-[4-[(4-benzyl-3,6-dihydro-2H-pyran-5-yl)methoxy]-2-(1,1-difluoroethyl)phenyl]propanoic acid |
| SMILES | CC(F)(F)c1cc(OCC2=C(Cc3ccccc3)CCOC2)ccc1CCC(=O)O |
| InChI | InChI=1S/C24H26F2O4/c1-24(25,26)22-14-21(9-7-18(22)8-10-23(27)28)30-16-20-15-29-12-11-19(20)13-17-5-3-2-4-6-17/h2-7,9,14H,8,10-13,15-16H2,1H3,(H,27,28) |
| InChIKey | YEOPTFABZDDTPB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|