C22H29F3O4 — CID 139466705
ethyl 3-[4-[(4-butan-2-yl-3,6-dihydro-2H-pyran-5-yl)methoxy]-2-(trifluoromethyl)phenyl]propanoate (PubChem CID 139466705) has the molecular formula C22H29F3O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is ethyl 3-[4-[(4-butan-2-yl-3,6-dihydro-2H-pyran-5-yl)methoxy]-2-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 3-[4-[(4-butan-2-yl-3,6-dihydro-2H-pyran-5-yl)methoxy]-2-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 139466705 |
| Molecular Formula | C22H29F3O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | ethyl 3-[4-[(4-butan-2-yl-3,6-dihydro-2H-pyran-5-yl)methoxy]-2-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCC2=C(C(C)CC)CCOC2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H29F3O4/c1-4-15(3)19-10-11-27-13-17(19)14-29-18-8-6-16(7-9-21(26)28-5-2)20(12-18)22(23,24)25/h6,8,12,15H,4-5,7,9-11,13-14H2,1-3H3 |
| InChIKey | UZJFIMKLYQYYKV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|