C24H25F3O3 — CID 162702634
3-[4-[[2-[(3-methylphenyl)methyl]cyclopenten-1-yl]methoxy]-2-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 162702634) has the molecular formula C24H25F3O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 3-[4-[[2-[(3-methylphenyl)methyl]cyclopenten-1-yl]methoxy]-2-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-[4-[[2-[(3-methylphenyl)methyl]cyclopenten-1-yl]methoxy]-2-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 162702634 |
| Molecular Formula | C24H25F3O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-[4-[[2-[(3-methylphenyl)methyl]cyclopenten-1-yl]methoxy]-2-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | Cc1cccc(CC2=C(COc3ccc(CCC(=O)O)c(C(F)(F)F)c3)CCC2)c1 |
| InChI | InChI=1S/C24H25F3O3/c1-16-4-2-5-17(12-16)13-19-6-3-7-20(19)15-30-21-10-8-18(9-11-23(28)29)22(14-21)24(25,26)27/h2,4-5,8,10,12,14H,3,6-7,9,11,13,15H2,1H3,(H,28,29) |
| InChIKey | KVAJUVFJDRIXEP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|