C20H26O3 — CID 139480413
3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]phenyl]propanoic acid (PubChem CID 139480413) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139480413 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCC2=C(C3CCCC3)CCC2)cc1 |
| InChI | InChI=1S/C20H26O3/c21-20(22)13-10-15-8-11-18(12-9-15)23-14-17-6-3-7-19(17)16-4-1-2-5-16/h8-9,11-12,16H,1-7,10,13-14H2,(H,21,22) |
| InChIKey | LBLVSGNCAHIEGP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|