C22H34O3 — CID 143797232
3-[4-[(3,3-dimethylcyclodecyl)methoxy]phenyl]propanoic acid (PubChem CID 143797232) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 3-[4-[(3,3-dimethylcyclodecyl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[(3,3-dimethylcyclodecyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143797232 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 3-[4-[(3,3-dimethylcyclodecyl)methoxy]phenyl]propanoic acid |
| SMILES | CC1(C)CCCCCCCC(COc2ccc(CCC(=O)O)cc2)C1 |
| InChI | InChI=1S/C22H34O3/c1-22(2)15-7-5-3-4-6-8-19(16-22)17-25-20-12-9-18(10-13-20)11-14-21(23)24/h9-10,12-13,19H,3-8,11,14-17H2,1-2H3,(H,23,24) |
| InChIKey | RVBVCZPHRXWDLJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |