C32H37NO4 — CID 70123177
methyl (2S)-3-[4-(cyclohexylmethoxy)phenyl]-2-[[2-(2-phenylethyl)benzoyl]amino]propanoate (PubChem CID 70123177) has the molecular formula C32H37NO4 and a molecular weight of 499.65 g/mol. Its IUPAC name is methyl (2S)-3-[4-(cyclohexylmethoxy)phenyl]-2-[[2-(2-phenylethyl)benzoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-[4-(cyclohexylmethoxy)phenyl]-2-[[2-(2-phenylethyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 70123177 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | methyl (2S)-3-[4-(cyclohexylmethoxy)phenyl]-2-[[2-(2-phenylethyl)benzoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCC2CCCCC2)cc1)NC(=O)c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C32H37NO4/c1-36-32(35)30(22-25-17-20-28(21-18-25)37-23-26-12-6-3-7-13-26)33-31(34)29-15-9-8-14-27(29)19-16-24-10-4-2-5-11-24/h2,4-5,8-11,14-15,17-18,20-21,26,30H,3,6-7,12-13,16,19,22-23H2,1H3,(H,33,34)/t30-/m0/s1 |
| InChIKey | LHLZPZRSFWBHLW-PMERELPUSA-N |
| XLogP | 5.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |