C31H43NO3 — CID 142041257
2-tert-butyl-N-[(2S)-1-[4-(cyclohexylmethoxy)phenyl]-3-oxopropan-2-yl]-5-phenylpentanamide (PubChem CID 142041257) has the molecular formula C31H43NO3 and a molecular weight of 477.69 g/mol. Its IUPAC name is 2-tert-butyl-N-[(2S)-1-[4-(cyclohexylmethoxy)phenyl]-3-oxopropan-2-yl]-5-phenylpentanamide.
| Compound Name | 2-tert-butyl-N-[(2S)-1-[4-(cyclohexylmethoxy)phenyl]-3-oxopropan-2-yl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 142041257 |
| Molecular Formula | C31H43NO3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 2-tert-butyl-N-[(2S)-1-[4-(cyclohexylmethoxy)phenyl]-3-oxopropan-2-yl]-5-phenylpentanamide |
| SMILES | CC(C)(C)C(CCCc1ccccc1)C(=O)N[C@H](C=O)Cc1ccc(OCC2CCCCC2)cc1 |
| InChI | InChI=1S/C31H43NO3/c1-31(2,3)29(16-10-15-24-11-6-4-7-12-24)30(34)32-27(22-33)21-25-17-19-28(20-18-25)35-23-26-13-8-5-9-14-26/h4,6-7,11-12,17-20,22,26-27,29H,5,8-10,13-16,21,23H2,1-3H3,(H,32,34)/t27-,29?/m0/s1 |
| InChIKey | RUASESPKAZVNOT-BVOOQYFDSA-N |
| XLogP | 6.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|