C32H36O4 — CID 139887948
2-[2-[4-[4-(cyclohexylmethoxy)phenyl]phenyl]-2-oxoethyl]-5-phenylpentanoic acid (PubChem CID 139887948) has the molecular formula C32H36O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-[2-[4-[4-(cyclohexylmethoxy)phenyl]phenyl]-2-oxoethyl]-5-phenylpentanoic acid.
| Compound Name | 2-[2-[4-[4-(cyclohexylmethoxy)phenyl]phenyl]-2-oxoethyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 139887948 |
| Molecular Formula | C32H36O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2-[2-[4-[4-(cyclohexylmethoxy)phenyl]phenyl]-2-oxoethyl]-5-phenylpentanoic acid |
| SMILES | O=C(CC(CCCc1ccccc1)C(=O)O)c1ccc(-c2ccc(OCC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C32H36O4/c33-31(22-29(32(34)35)13-7-12-24-8-3-1-4-9-24)28-16-14-26(15-17-28)27-18-20-30(21-19-27)36-23-25-10-5-2-6-11-25/h1,3-4,8-9,14-21,25,29H,2,5-7,10-13,22-23H2,(H,34,35) |
| InChIKey | OTFQHRDKPALMTN-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |