C20H21BrO3 — CID 54453895
methyl 2-[2-(4-bromophenyl)-2-oxoethyl]-5-phenylpentanoate (PubChem CID 54453895) has the molecular formula C20H21BrO3 and a molecular weight of 389.29 g/mol. Its IUPAC name is methyl 2-[2-(4-bromophenyl)-2-oxoethyl]-5-phenylpentanoate.
| Compound Name | methyl 2-[2-(4-bromophenyl)-2-oxoethyl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 54453895 |
| Molecular Formula | C20H21BrO3 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | methyl 2-[2-(4-bromophenyl)-2-oxoethyl]-5-phenylpentanoate |
| SMILES | COC(=O)C(CCCc1ccccc1)CC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H21BrO3/c1-24-20(23)17(9-5-8-15-6-3-2-4-7-15)14-19(22)16-10-12-18(21)13-11-16/h2-4,6-7,10-13,17H,5,8-9,14H2,1H3 |
| InChIKey | WWVIUZYBYDIKSW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |