C22H27BrN2O4 — CID 59064549
4-bromo-N-[(2S,4S)-1-hydroxy-4-(hydroxycarbamoyl)-7-phenylheptan-2-yl]-N-methylbenzamide (PubChem CID 59064549) has the molecular formula C22H27BrN2O4 and a molecular weight of 463.37 g/mol. Its IUPAC name is 4-bromo-N-[(2S,4S)-1-hydroxy-4-(hydroxycarbamoyl)-7-phenylheptan-2-yl]-N-methylbenzamide.
| Compound Name | 4-bromo-N-[(2S,4S)-1-hydroxy-4-(hydroxycarbamoyl)-7-phenylheptan-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 59064549 |
| Molecular Formula | C22H27BrN2O4 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 4-bromo-N-[(2S,4S)-1-hydroxy-4-(hydroxycarbamoyl)-7-phenylheptan-2-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Br)cc1)[C@H](CO)C[C@H](CCCc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C22H27BrN2O4/c1-25(22(28)17-10-12-19(23)13-11-17)20(15-26)14-18(21(27)24-29)9-5-8-16-6-3-2-4-7-16/h2-4,6-7,10-13,18,20,26,29H,5,8-9,14-15H2,1H3,(H,24,27)/t18-,20-/m0/s1 |
| InChIKey | RWDICKYTNLMSDL-ICSRJNTNSA-N |
| XLogP | 3.42 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|