C24H23N3O4 — CID 89412989
N-benzyl-N'-hydroxy-2-[methyl-(4-phenylbenzoyl)amino]propanediamide (PubChem CID 89412989) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-benzyl-N'-hydroxy-2-[methyl-(4-phenylbenzoyl)amino]propanediamide.
| Compound Name | N-benzyl-N'-hydroxy-2-[methyl-(4-phenylbenzoyl)amino]propanediamide |
|---|---|
| PubChem CID | 89412989 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-benzyl-N'-hydroxy-2-[methyl-(4-phenylbenzoyl)amino]propanediamide |
| SMILES | CN(C(=O)c1ccc(-c2ccccc2)cc1)C(C(=O)NO)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H23N3O4/c1-27(21(23(29)26-31)22(28)25-16-17-8-4-2-5-9-17)24(30)20-14-12-19(13-15-20)18-10-6-3-7-11-18/h2-15,21,31H,16H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | BEPXKHXLSWVZNR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|