C20H23N3O4 — CID 89413611
N-hydroxy-2-[methyl-(4-phenylbenzoyl)amino]-N'-propylpropanediamide (PubChem CID 89413611) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-hydroxy-2-[methyl-(4-phenylbenzoyl)amino]-N'-propylpropanediamide.
| Compound Name | N-hydroxy-2-[methyl-(4-phenylbenzoyl)amino]-N'-propylpropanediamide |
|---|---|
| PubChem CID | 89413611 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-hydroxy-2-[methyl-(4-phenylbenzoyl)amino]-N'-propylpropanediamide |
| SMILES | CCCNC(=O)C(C(=O)NO)N(C)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-3-13-21-18(24)17(19(25)22-27)23(2)20(26)16-11-9-15(10-12-16)14-7-5-4-6-8-14/h4-12,17,27H,3,13H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | IHYWWMLKJSHPRF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|