C24H24BrN3O2 — CID 46864752
N-[3-[(4-bromobenzoyl)-methylamino]-4-phenylbutyl]pyridine-2-carboxamide (PubChem CID 46864752) has the molecular formula C24H24BrN3O2 and a molecular weight of 466.38 g/mol. Its IUPAC name is N-[3-[(4-bromobenzoyl)-methylamino]-4-phenylbutyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[(4-bromobenzoyl)-methylamino]-4-phenylbutyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 46864752 |
| Molecular Formula | C24H24BrN3O2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[3-[(4-bromobenzoyl)-methylamino]-4-phenylbutyl]pyridine-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(Br)cc1)C(CCNC(=O)c1ccccn1)Cc1ccccc1 |
| InChI | InChI=1S/C24H24BrN3O2/c1-28(24(30)19-10-12-20(25)13-11-19)21(17-18-7-3-2-4-8-18)14-16-27-23(29)22-9-5-6-15-26-22/h2-13,15,21H,14,16-17H2,1H3,(H,27,29) |
| InChIKey | PDFHDLSPNYUBTO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |