C28H30N4O3 — CID 46864706
N-[3-[(4-methoxybenzoyl)-methylamino]-4-phenylbutyl]-1-methylbenzimidazole-2-carboxamide (PubChem CID 46864706) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[3-[(4-methoxybenzoyl)-methylamino]-4-phenylbutyl]-1-methylbenzimidazole-2-carboxamide.
| Compound Name | N-[3-[(4-methoxybenzoyl)-methylamino]-4-phenylbutyl]-1-methylbenzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 46864706 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-[3-[(4-methoxybenzoyl)-methylamino]-4-phenylbutyl]-1-methylbenzimidazole-2-carboxamide |
| SMILES | COc1ccc(C(=O)N(C)C(CCNC(=O)c2nc3ccccc3n2C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N4O3/c1-31(28(34)21-13-15-23(35-3)16-14-21)22(19-20-9-5-4-6-10-20)17-18-29-27(33)26-30-24-11-7-8-12-25(24)32(26)2/h4-16,22H,17-19H2,1-3H3,(H,29,33) |
| InChIKey | BFLHPMJRUSEELX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |