C25H33N3O4 — CID 15380776
(2S,3R)-3-[(N-acetylanilino)carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylpropyl)hexanamide (PubChem CID 15380776) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is (2S,3R)-3-[(N-acetylanilino)carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylpropyl)hexanamide.
| Compound Name | (2S,3R)-3-[(N-acetylanilino)carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylpropyl)hexanamide |
|---|---|
| PubChem CID | 15380776 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (2S,3R)-3-[(N-acetylanilino)carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylpropyl)hexanamide |
| SMILES | CC(=O)N(NC(=O)[C@H](CC(C)C)[C@H](CCCc1ccccc1)C(=O)NO)c1ccccc1 |
| InChI | InChI=1S/C25H33N3O4/c1-18(2)17-23(24(30)26-28(19(3)29)21-14-8-5-9-15-21)22(25(31)27-32)16-10-13-20-11-6-4-7-12-20/h4-9,11-12,14-15,18,22-23,32H,10,13,16-17H2,1-3H3,(H,26,30)(H,27,31)/t22-,23+/m0/s1 |
| InChIKey | DVDGZJYLEOWDNQ-XZOQPEGZSA-N |
| XLogP | 3.88 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|