C27H39N5O7 — CID 20681576
ethyl 3-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)-6-phenylhexanoyl]amino]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 20681576) has the molecular formula C27H39N5O7 and a molecular weight of 545.64 g/mol. Its IUPAC name is ethyl 3-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)-6-phenylhexanoyl]amino]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | ethyl 3-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)-6-phenylhexanoyl]amino]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 20681576 |
| Molecular Formula | C27H39N5O7 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | ethyl 3-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)-6-phenylhexanoyl]amino]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC1)NC(=O)N(NC(=O)C(CC(C)C)[C@H](CCCc1ccccc1)C(=O)NO)C2=O |
| InChI | InChI=1S/C27H39N5O7/c1-4-39-26(37)31-15-13-27(14-16-31)24(35)32(25(36)28-27)29-22(33)21(17-18(2)3)20(23(34)30-38)12-8-11-19-9-6-5-7-10-19/h5-7,9-10,18,20-21,38H,4,8,11-17H2,1-3H3,(H,28,36)(H,29,33)(H,30,34)/t20-,21?/m0/s1 |
| InChIKey | NGCFAFRCHJYWBT-BGERDNNASA-N |
| XLogP | 2.37 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|