C18H25NO5 — CID 69434740
methyl 2-[(1S)-1-hydroxy-2-morpholin-4-yl-2-oxoethyl]-5-phenylpentanoate (PubChem CID 69434740) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl 2-[(1S)-1-hydroxy-2-morpholin-4-yl-2-oxoethyl]-5-phenylpentanoate.
| Compound Name | methyl 2-[(1S)-1-hydroxy-2-morpholin-4-yl-2-oxoethyl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 69434740 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | methyl 2-[(1S)-1-hydroxy-2-morpholin-4-yl-2-oxoethyl]-5-phenylpentanoate |
| SMILES | COC(=O)C(CCCc1ccccc1)[C@H](O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H25NO5/c1-23-18(22)15(9-5-8-14-6-3-2-4-7-14)16(20)17(21)19-10-12-24-13-11-19/h2-4,6-7,15-16,20H,5,8-13H2,1H3/t15?,16-/m0/s1 |
| InChIKey | ARRFONDCDPQPHQ-LYKKTTPLSA-N |
| XLogP | 1.02 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |