C13H19N2O2+ — CID 40562536
[(2S)-1-morpholin-4-yl-1-oxo-3-phenylpropan-2-yl]azanium (PubChem CID 40562536) has the molecular formula C13H19N2O2+ and a molecular weight of 235.31 g/mol. Its IUPAC name is [(2S)-1-morpholin-4-yl-1-oxo-3-phenylpropan-2-yl]azanium.
| Compound Name | [(2S)-1-morpholin-4-yl-1-oxo-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 40562536 |
| Molecular Formula | C13H19N2O2+ |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | [(2S)-1-morpholin-4-yl-1-oxo-3-phenylpropan-2-yl]azanium |
| SMILES | [NH3+][C@@H](Cc1ccccc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H18N2O2/c14-12(10-11-4-2-1-3-5-11)13(16)15-6-8-17-9-7-15/h1-5,12H,6-10,14H2/p+1/t12-/m0/s1 |
| InChIKey | NUAMZZJTBNPSTD-LBPRGKRZSA-O |
| XLogP | -0.30 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |