C19H21NO5S — CID 142671079
4-[(2R)-3-morpholin-4-yl-3-oxo-2-phenylpropyl]benzenesulfonic acid (PubChem CID 142671079) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[(2R)-3-morpholin-4-yl-3-oxo-2-phenylpropyl]benzenesulfonic acid.
| Compound Name | 4-[(2R)-3-morpholin-4-yl-3-oxo-2-phenylpropyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 142671079 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-[(2R)-3-morpholin-4-yl-3-oxo-2-phenylpropyl]benzenesulfonic acid |
| SMILES | O=C([C@H](Cc1ccc(S(=O)(=O)O)cc1)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C19H21NO5S/c21-19(20-10-12-25-13-11-20)18(16-4-2-1-3-5-16)14-15-6-8-17(9-7-15)26(22,23)24/h1-9,18H,10-14H2,(H,22,23,24)/t18-/m1/s1 |
| InChIKey | STQMUNLLDAPOLR-GOSISDBHSA-N |
| XLogP | 2.12 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|