C20H24N2O — CID 71449759
1-(4-methylpiperazin-1-yl)-2,3-diphenylpropan-1-one (PubChem CID 71449759) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2,3-diphenylpropan-1-one.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 71449759 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2,3-diphenylpropan-1-one |
| SMILES | CN1CCN(C(=O)C(Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N2O/c1-21-12-14-22(15-13-21)20(23)19(18-10-6-3-7-11-18)16-17-8-4-2-5-9-17/h2-11,19H,12-16H2,1H3 |
| InChIKey | AMEZAJPSLZEMQP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |