C20H24N2O — CID 110407270
1-(4-methylpiperidin-1-yl)-2-phenyl-3-pyridin-4-ylpropan-1-one (PubChem CID 110407270) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-2-phenyl-3-pyridin-4-ylpropan-1-one.
| Compound Name | 1-(4-methylpiperidin-1-yl)-2-phenyl-3-pyridin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 110407270 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-2-phenyl-3-pyridin-4-ylpropan-1-one |
| SMILES | CC1CCN(C(=O)C(Cc2ccncc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N2O/c1-16-9-13-22(14-10-16)20(23)19(18-5-3-2-4-6-18)15-17-7-11-21-12-8-17/h2-8,11-12,16,19H,9-10,13-15H2,1H3 |
| InChIKey | YOVJELCJZRERKD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |