C24H31N3O2 — CID 110624572
1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-2-phenyl-3-pyridin-3-ylpropan-1-one (PubChem CID 110624572) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-2-phenyl-3-pyridin-3-ylpropan-1-one.
| Compound Name | 1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-2-phenyl-3-pyridin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 110624572 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-[4-(morpholin-4-ylmethyl)piperidin-1-yl]-2-phenyl-3-pyridin-3-ylpropan-1-one |
| SMILES | O=C(C(Cc1cccnc1)c1ccccc1)N1CCC(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C24H31N3O2/c28-24(27-11-8-20(9-12-27)19-26-13-15-29-16-14-26)23(22-6-2-1-3-7-22)17-21-5-4-10-25-18-21/h1-7,10,18,20,23H,8-9,11-17,19H2 |
| InChIKey | REYCJMHUAXNYLA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |