C24H23FN2O2 — CID 110609353
1-[2-(2-fluorophenyl)morpholin-4-yl]-2-phenyl-3-pyridin-3-ylpropan-1-one (PubChem CID 110609353) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)morpholin-4-yl]-2-phenyl-3-pyridin-3-ylpropan-1-one.
| Compound Name | 1-[2-(2-fluorophenyl)morpholin-4-yl]-2-phenyl-3-pyridin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 110609353 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[2-(2-fluorophenyl)morpholin-4-yl]-2-phenyl-3-pyridin-3-ylpropan-1-one |
| SMILES | O=C(C(Cc1cccnc1)c1ccccc1)N1CCOC(c2ccccc2F)C1 |
| InChI | InChI=1S/C24H23FN2O2/c25-22-11-5-4-10-20(22)23-17-27(13-14-29-23)24(28)21(19-8-2-1-3-9-19)15-18-7-6-12-26-16-18/h1-12,16,21,23H,13-15,17H2 |
| InChIKey | QGTCNFBPYXSMHF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |