C20H23ClN2O2 — CID 110311432
2-(4-chlorophenyl)-1-[3-(hydroxymethyl)piperidin-1-yl]-3-pyridin-3-ylpropan-1-one (PubChem CID 110311432) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[3-(hydroxymethyl)piperidin-1-yl]-3-pyridin-3-ylpropan-1-one.
| Compound Name | 2-(4-chlorophenyl)-1-[3-(hydroxymethyl)piperidin-1-yl]-3-pyridin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 110311432 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[3-(hydroxymethyl)piperidin-1-yl]-3-pyridin-3-ylpropan-1-one |
| SMILES | O=C(C(Cc1cccnc1)c1ccc(Cl)cc1)N1CCCC(CO)C1 |
| InChI | InChI=1S/C20H23ClN2O2/c21-18-7-5-17(6-8-18)19(11-15-3-1-9-22-12-15)20(25)23-10-2-4-16(13-23)14-24/h1,3,5-9,12,16,19,24H,2,4,10-11,13-14H2 |
| InChIKey | IAWCDVIXODDWRM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |