C23H30ClN3O — CID 110301790
2-(4-chlorophenyl)-N-[2-(4-methylpiperidin-1-yl)propyl]-3-pyridin-3-ylpropanamide (PubChem CID 110301790) has the molecular formula C23H30ClN3O and a molecular weight of 399.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(4-methylpiperidin-1-yl)propyl]-3-pyridin-3-ylpropanamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(4-methylpiperidin-1-yl)propyl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 110301790 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(4-methylpiperidin-1-yl)propyl]-3-pyridin-3-ylpropanamide |
| SMILES | CC1CCN(C(C)CNC(=O)C(Cc2cccnc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H30ClN3O/c1-17-9-12-27(13-10-17)18(2)15-26-23(28)22(14-19-4-3-11-25-16-19)20-5-7-21(24)8-6-20/h3-8,11,16-18,22H,9-10,12-15H2,1-2H3,(H,26,28) |
| InChIKey | SRPNHCLIVUNKNL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |