C19H21N3O2 — CID 110625050
N-[2-(cyclopropylamino)-2-oxoethyl]-2-phenyl-3-pyridin-4-ylpropanamide (PubChem CID 110625050) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]-2-phenyl-3-pyridin-4-ylpropanamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]-2-phenyl-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 110625050 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]-2-phenyl-3-pyridin-4-ylpropanamide |
| SMILES | O=C(CNC(=O)C(Cc1ccncc1)c1ccccc1)NC1CC1 |
| InChI | InChI=1S/C19H21N3O2/c23-18(22-16-6-7-16)13-21-19(24)17(15-4-2-1-3-5-15)12-14-8-10-20-11-9-14/h1-5,8-11,16-17H,6-7,12-13H2,(H,21,24)(H,22,23) |
| InChIKey | BQTDVUCWAVHAON-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |