C19H22N2O — CID 110307425
1-cyclopropyl-3-(2,3-diphenylpropyl)urea (PubChem CID 110307425) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,3-diphenylpropyl)urea.
| Compound Name | 1-cyclopropyl-3-(2,3-diphenylpropyl)urea |
|---|---|
| PubChem CID | 110307425 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-cyclopropyl-3-(2,3-diphenylpropyl)urea |
| SMILES | O=C(NCC(Cc1ccccc1)c1ccccc1)NC1CC1 |
| InChI | InChI=1S/C19H22N2O/c22-19(21-18-11-12-18)20-14-17(16-9-5-2-6-10-16)13-15-7-3-1-4-8-15/h1-10,17-18H,11-14H2,(H2,20,21,22) |
| InChIKey | CFVQRVXVUCBOTJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |