C22H28N3O5+ — CID 143421129
[(2S)-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenoxy]phenyl]-1-morpholin-4-yl-1-oxopropan-2-yl]azanium (PubChem CID 143421129) has the molecular formula C22H28N3O5+ and a molecular weight of 414.48 g/mol. Its IUPAC name is [(2S)-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenoxy]phenyl]-1-morpholin-4-yl-1-oxopropan-2-yl]azanium.
| Compound Name | [(2S)-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenoxy]phenyl]-1-morpholin-4-yl-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 143421129 |
| Molecular Formula | C22H28N3O5+ |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [(2S)-3-[4-[4-[3-(hydroxyamino)-3-oxopropyl]phenoxy]phenyl]-1-morpholin-4-yl-1-oxopropan-2-yl]azanium |
| SMILES | [NH3+][C@@H](Cc1ccc(Oc2ccc(CCC(=O)NO)cc2)cc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H27N3O5/c23-20(22(27)25-11-13-29-14-12-25)15-17-3-8-19(9-4-17)30-18-6-1-16(2-7-18)5-10-21(26)24-28/h1-4,6-9,20,28H,5,10-15,23H2,(H,24,26)/p+1/t20-/m0/s1 |
| InChIKey | LZWGZCFGSNZFKD-FQEVSTJZSA-O |
| XLogP | 0.93 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|