C32H43N5O7S — CID 20681471
4-methyl-N-(8-methylsulfonyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-N-[(2S)-1-oxo-5-phenyl-1-(phenylmethoxyamino)pentan-2-yl]pentanamide (PubChem CID 20681471) has the molecular formula C32H43N5O7S and a molecular weight of 641.79 g/mol. Its IUPAC name is 4-methyl-N-(8-methylsulfonyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-N-[(2S)-1-oxo-5-phenyl-1-(phenylmethoxyamino)pentan-2-yl]pentanamide.
| Compound Name | 4-methyl-N-(8-methylsulfonyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-N-[(2S)-1-oxo-5-phenyl-1-(phenylmethoxyamino)pentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 20681471 |
| Molecular Formula | C32H43N5O7S |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | 4-methyl-N-(8-methylsulfonyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-N-[(2S)-1-oxo-5-phenyl-1-(phenylmethoxyamino)pentan-2-yl]pentanamide |
| SMILES | CC(C)CCC(=O)N([C@@H](CCCc1ccccc1)C(=O)NOCc1ccccc1)N1C(=O)NC2(CCN(S(C)(=O)=O)CC2)C1=O |
| InChI | InChI=1S/C32H43N5O7S/c1-24(2)17-18-28(38)36(37-30(40)32(33-31(37)41)19-21-35(22-20-32)45(3,42)43)27(16-10-15-25-11-6-4-7-12-25)29(39)34-44-23-26-13-8-5-9-14-26/h4-9,11-14,24,27H,10,15-23H2,1-3H3,(H,33,41)(H,34,39)/t27-/m0/s1 |
| InChIKey | ZTUVUNOILICYAT-MHZLTWQESA-N |
| XLogP | 3.15 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|