C27H33N2O3P — CID 18666515
(2R)-2-[benzyl-[methyl(phenyl)phosphoryl]amino]-4-methyl-N-phenylmethoxypentanamide (PubChem CID 18666515) has the molecular formula C27H33N2O3P and a molecular weight of 464.55 g/mol. Its IUPAC name is (2R)-2-[benzyl-[methyl(phenyl)phosphoryl]amino]-4-methyl-N-phenylmethoxypentanamide.
| Compound Name | (2R)-2-[benzyl-[methyl(phenyl)phosphoryl]amino]-4-methyl-N-phenylmethoxypentanamide |
|---|---|
| PubChem CID | 18666515 |
| Molecular Formula | C27H33N2O3P |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (2R)-2-[benzyl-[methyl(phenyl)phosphoryl]amino]-4-methyl-N-phenylmethoxypentanamide |
| SMILES | CC(C)C[C@H](C(=O)NOCc1ccccc1)N(Cc1ccccc1)P(C)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H33N2O3P/c1-22(2)19-26(27(30)28-32-21-24-15-9-5-10-16-24)29(20-23-13-7-4-8-14-23)33(3,31)25-17-11-6-12-18-25/h4-18,22,26H,19-21H2,1-3H3,(H,28,30)/t26-,33?/m1/s1 |
| InChIKey | VRFNUGKYAOEODC-UOQVMRJOSA-N |
| XLogP | 5.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|