C16H26NO3P — CID 57270587
methyl (2S)-2-[benzyl(dimethylphosphoryl)amino]-4-methylpentanoate (PubChem CID 57270587) has the molecular formula C16H26NO3P and a molecular weight of 311.36 g/mol. Its IUPAC name is methyl (2S)-2-[benzyl(dimethylphosphoryl)amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[benzyl(dimethylphosphoryl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 57270587 |
| Molecular Formula | C16H26NO3P |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | methyl (2S)-2-[benzyl(dimethylphosphoryl)amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)N(Cc1ccccc1)P(C)(C)=O |
| InChI | InChI=1S/C16H26NO3P/c1-13(2)11-15(16(18)20-3)17(21(4,5)19)12-14-9-7-6-8-10-14/h6-10,13,15H,11-12H2,1-5H3/t15-/m0/s1 |
| InChIKey | WLSPJGVWVCMSLB-HNNXBMFYSA-N |
| XLogP | 3.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|