C18H29N2O5P — CID 70536181
methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]-[methoxy(methyl)phosphoryl]amino]-4-methylpentanoate (PubChem CID 70536181) has the molecular formula C18H29N2O5P and a molecular weight of 384.41 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]-[methoxy(methyl)phosphoryl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]-[methoxy(methyl)phosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 70536181 |
| Molecular Formula | C18H29N2O5P |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]-[methoxy(methyl)phosphoryl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)N(C(=O)[C@@H](N)Cc1ccccc1)P(C)(=O)OC |
| InChI | InChI=1S/C18H29N2O5P/c1-13(2)11-16(18(22)24-3)20(26(5,23)25-4)17(21)15(19)12-14-9-7-6-8-10-14/h6-10,13,15-16H,11-12,19H2,1-5H3/t15-,16-,26?/m0/s1 |
| InChIKey | XIZPBIMIHMUMKQ-ZIZWBSLWSA-N |
| XLogP | 2.44 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|