C25H33N3O4 — CID 67739621
methyl (2S)-2-[bis[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate (PubChem CID 67739621) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is methyl (2S)-2-[bis[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[bis[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 67739621 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | methyl (2S)-2-[bis[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)N(C(=O)[C@@H](N)Cc1ccccc1)C(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C25H33N3O4/c1-17(2)14-22(25(31)32-3)28(23(29)20(26)15-18-10-6-4-7-11-18)24(30)21(27)16-19-12-8-5-9-13-19/h4-13,17,20-22H,14-16,26-27H2,1-3H3/t20-,21-,22-/m0/s1 |
| InChIKey | GTGIEMWVNCTRBQ-FKBYEOEOSA-N |
| XLogP | 2.07 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |