C20H30N2O5 — CID 70043967
2-[(2-amino-3-phenylpropanoyl)-butoxycarbonylamino]-4-methylpentanoic acid (PubChem CID 70043967) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[(2-amino-3-phenylpropanoyl)-butoxycarbonylamino]-4-methylpentanoic acid.
| Compound Name | 2-[(2-amino-3-phenylpropanoyl)-butoxycarbonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 70043967 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-[(2-amino-3-phenylpropanoyl)-butoxycarbonylamino]-4-methylpentanoic acid |
| SMILES | CCCCOC(=O)N(C(=O)C(N)Cc1ccccc1)C(CC(C)C)C(=O)O |
| InChI | InChI=1S/C20H30N2O5/c1-4-5-11-27-20(26)22(17(19(24)25)12-14(2)3)18(23)16(21)13-15-9-7-6-8-10-15/h6-10,14,16-17H,4-5,11-13,21H2,1-3H3,(H,24,25) |
| InChIKey | DSSYCVXEQUNKCM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|