C17H24N2O6 — CID 70470056
2-[(2-amino-3-hydroxypropanoyl)-phenylmethoxycarbonylamino]-4-methylpentanoic acid (PubChem CID 70470056) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[(2-amino-3-hydroxypropanoyl)-phenylmethoxycarbonylamino]-4-methylpentanoic acid.
| Compound Name | 2-[(2-amino-3-hydroxypropanoyl)-phenylmethoxycarbonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 70470056 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[(2-amino-3-hydroxypropanoyl)-phenylmethoxycarbonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N(C(=O)OCc1ccccc1)C(=O)C(N)CO |
| InChI | InChI=1S/C17H24N2O6/c1-11(2)8-14(16(22)23)19(15(21)13(18)9-20)17(24)25-10-12-6-4-3-5-7-12/h3-7,11,13-14,20H,8-10,18H2,1-2H3,(H,22,23) |
| InChIKey | UYIUIMASZXPACY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |