C14H17ClN2O5 — CID 70558855
(2S)-2-[[(2S)-2-aminopropanoyl]-phenylmethoxycarbonylamino]-3-chloropropanoic acid (PubChem CID 70558855) has the molecular formula C14H17ClN2O5 and a molecular weight of 328.75 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-aminopropanoyl]-phenylmethoxycarbonylamino]-3-chloropropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-aminopropanoyl]-phenylmethoxycarbonylamino]-3-chloropropanoic acid |
|---|---|
| PubChem CID | 70558855 |
| Molecular Formula | C14H17ClN2O5 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (2S)-2-[[(2S)-2-aminopropanoyl]-phenylmethoxycarbonylamino]-3-chloropropanoic acid |
| SMILES | C[C@H](N)C(=O)N(C(=O)OCc1ccccc1)[C@H](CCl)C(=O)O |
| InChI | InChI=1S/C14H17ClN2O5/c1-9(16)12(18)17(11(7-15)13(19)20)14(21)22-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8,16H2,1H3,(H,19,20)/t9-,11+/m0/s1 |
| InChIKey | LAHMEORHPLAGFP-GXSJLCMTSA-N |
| XLogP | 1.19 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|