C16H20N2O6 — CID 18598820
(2R)-2-amino-5-oxo-5-[[(2R)-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]pentanoic acid (PubChem CID 18598820) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is (2R)-2-amino-5-oxo-5-[[(2R)-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]pentanoic acid.
| Compound Name | (2R)-2-amino-5-oxo-5-[[(2R)-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 18598820 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2R)-2-amino-5-oxo-5-[[(2R)-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]pentanoic acid |
| SMILES | C[C@H](C=O)N(C(=O)CC[C@@H](N)C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H20N2O6/c1-11(9-19)18(14(20)8-7-13(17)15(21)22)16(23)24-10-12-5-3-2-4-6-12/h2-6,9,11,13H,7-8,10,17H2,1H3,(H,21,22)/t11-,13-/m1/s1 |
| InChIKey | SUOXASWNCGWQIB-DGCLKSJQSA-N |
| XLogP | 0.93 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|