C19H29N3O3 — CID 54279048
(2S)-2,6-diamino-N-[(2S)-1-oxopropan-2-yl]-N-(4-phenylbutanoyl)hexanamide (PubChem CID 54279048) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2S)-1-oxopropan-2-yl]-N-(4-phenylbutanoyl)hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2S)-1-oxopropan-2-yl]-N-(4-phenylbutanoyl)hexanamide |
|---|---|
| PubChem CID | 54279048 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2S)-1-oxopropan-2-yl]-N-(4-phenylbutanoyl)hexanamide |
| SMILES | C[C@@H](C=O)N(C(=O)CCCc1ccccc1)C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C19H29N3O3/c1-15(14-23)22(19(25)17(21)11-5-6-13-20)18(24)12-7-10-16-8-3-2-4-9-16/h2-4,8-9,14-15,17H,5-7,10-13,20-21H2,1H3/t15-,17-/m0/s1 |
| InChIKey | BRIXRWCJMDQLLN-RDJZCZTQSA-N |
| XLogP | 1.41 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|