C15H25N3O2 — CID 57272495
(2R)-2,5-diamino-N-(2-hydroxyethyl)-N-(2-phenylethyl)pentanamide (PubChem CID 57272495) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is (2R)-2,5-diamino-N-(2-hydroxyethyl)-N-(2-phenylethyl)pentanamide.
| Compound Name | (2R)-2,5-diamino-N-(2-hydroxyethyl)-N-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 57272495 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (2R)-2,5-diamino-N-(2-hydroxyethyl)-N-(2-phenylethyl)pentanamide |
| SMILES | NCCC[C@@H](N)C(=O)N(CCO)CCc1ccccc1 |
| InChI | InChI=1S/C15H25N3O2/c16-9-4-7-14(17)15(20)18(11-12-19)10-8-13-5-2-1-3-6-13/h1-3,5-6,14,19H,4,7-12,16-17H2/t14-/m1/s1 |
| InChIKey | IRTGSQQZEDQBFY-CQSZACIVSA-N |
| XLogP | 0.12 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |