C15H24N2O — CID 157262351
(6S)-6,9-diamino-1-phenylnonan-4-one (PubChem CID 157262351) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (6S)-6,9-diamino-1-phenylnonan-4-one.
| Compound Name | (6S)-6,9-diamino-1-phenylnonan-4-one |
|---|---|
| PubChem CID | 157262351 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (6S)-6,9-diamino-1-phenylnonan-4-one |
| SMILES | NCCC[C@H](N)CC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C15H24N2O/c16-11-5-9-14(17)12-15(18)10-4-8-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12,16-17H2/t14-/m0/s1 |
| InChIKey | AXPJVNRXJOJETA-AWEZNQCLSA-N |
| XLogP | 2.03 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |