C18H21NO — CID 116552978
1-amino-1,6-diphenylhexan-3-one (PubChem CID 116552978) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-amino-1,6-diphenylhexan-3-one.
| Compound Name | 1-amino-1,6-diphenylhexan-3-one |
|---|---|
| PubChem CID | 116552978 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-amino-1,6-diphenylhexan-3-one |
| SMILES | NC(CC(=O)CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO/c19-18(16-11-5-2-6-12-16)14-17(20)13-7-10-15-8-3-1-4-9-15/h1-6,8-9,11-12,18H,7,10,13-14,19H2 |
| InChIKey | BUQOJCCTLDFDSJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |