C16H19N — CID 7131342
(1R)-1,4-diphenylbutan-1-amine (PubChem CID 7131342) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is (1R)-1,4-diphenylbutan-1-amine.
| Compound Name | (1R)-1,4-diphenylbutan-1-amine |
|---|---|
| PubChem CID | 7131342 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (1R)-1,4-diphenylbutan-1-amine |
| SMILES | N[C@H](CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19N/c17-16(15-11-5-2-6-12-15)13-7-10-14-8-3-1-4-9-14/h1-6,8-9,11-12,16H,7,10,13,17H2/t16-/m1/s1 |
| InChIKey | NHFFVYVFZANMOU-MRXNPFEDSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |