C16H18IN — CID 115849348
1-(3-iodophenyl)-4-phenylbutan-1-amine (PubChem CID 115849348) has the molecular formula C16H18IN and a molecular weight of 351.23 g/mol. Its IUPAC name is 1-(3-iodophenyl)-4-phenylbutan-1-amine.
| Compound Name | 1-(3-iodophenyl)-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 115849348 |
| Molecular Formula | C16H18IN |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-(3-iodophenyl)-4-phenylbutan-1-amine |
| SMILES | NC(CCCc1ccccc1)c1cccc(I)c1 |
| InChI | InChI=1S/C16H18IN/c17-15-10-5-9-14(12-15)16(18)11-4-8-13-6-2-1-3-7-13/h1-3,5-7,9-10,12,16H,4,8,11,18H2 |
| InChIKey | JCSLGLLVHMNLLE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|