C11H18ClIN2 — CID 171210552
(1R)-1-(3-iodophenyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171210552) has the molecular formula C11H18ClIN2 and a molecular weight of 340.64 g/mol. Its IUPAC name is (1R)-1-(3-iodophenyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-(3-iodophenyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171210552 |
| Molecular Formula | C11H18ClIN2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (1R)-1-(3-iodophenyl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1cccc(I)c1 |
| InChI | InChI=1S/C11H17IN2.ClH/c12-10-5-3-4-9(8-10)11(14)6-1-2-7-13;/h3-5,8,11H,1-2,6-7,13-14H2;1H/t11-;/m1./s1 |
| InChIKey | IUPCIAJFNGSHAB-RFVHGSKJSA-N |
| XLogP | 2.84 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|