C10H18ClN3 — CID 171221036
(1S)-1-pyridin-3-ylpentane-1,5-diamine;hydrochloride (PubChem CID 171221036) has the molecular formula C10H18ClN3 and a molecular weight of 215.73 g/mol. Its IUPAC name is (1S)-1-pyridin-3-ylpentane-1,5-diamine;hydrochloride.
| Compound Name | (1S)-1-pyridin-3-ylpentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171221036 |
| Molecular Formula | C10H18ClN3 |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (1S)-1-pyridin-3-ylpentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1cccnc1 |
| InChI | InChI=1S/C10H17N3.ClH/c11-6-2-1-5-10(12)9-4-3-7-13-8-9;/h3-4,7-8,10H,1-2,5-6,11-12H2;1H/t10-;/m0./s1 |
| InChIKey | MCJXGWMTMDDMEP-PPHPATTJSA-N |
| XLogP | 1.63 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|